Imidazole-1-ethanol, 2-methyl-
Catalog No: FT-0693413
CAS No: 1615-15-2
- Chemical Name: Imidazole-1-ethanol, 2-methyl-
- Molecular Formula: C6H10N2O
- Molecular Weight: 126.16
- InChI Key: JJWKKSUCSNDHNJ-UHFFFAOYSA-N
- InChI: InChI=1S/C6H10N2O/c1-6-7-2-3-8(6)4-5-9/h2-3,9H,4-5H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 1615-15-2 |
| Flash_Point: | 134.3ºC |
| Product_Name: | 2-(2-Methyl-1H-imidazol-1-yl)ethanol |
| Bolling_Point: | 298.5ºC at 760mmHg |
| FW: | 126.15600 |
| Melting_Point: | N/A |
| MF: | C6H10N2O |
| Density: | 1.12g/cm3 |
| Refractive_Index: | 1.541 |
|---|---|
| Vapor_Pressure: | 0.000566mmHg at 25°C |
| MF: | C6H10N2O |
| Flash_Point: | 134.3ºC |
| LogP: | 0.18380 |
| FW: | 126.15600 |
| Density: | 1.12g/cm3 |
| PSA: | 38.05000 |
| Bolling_Point: | 298.5ºC at 760mmHg |
| Exact_Mass: | 126.07900 |
| Symbol: | GHS05, GHS07 |
|---|---|
| HS_Code: | 2933290090 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H318 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)